C8H8F5N3 — CID 171312582
3-[(1R)-1-amino-2,2,3,3,3-pentafluoropropyl]pyridin-2-amine (PubChem CID 171312582) has the molecular formula C8H8F5N3 and a molecular weight of 241.16 g/mol. Its IUPAC name is 3-[(1R)-1-amino-2,2,3,3,3-pentafluoropropyl]pyridin-2-amine.
| Compound Name | 3-[(1R)-1-amino-2,2,3,3,3-pentafluoropropyl]pyridin-2-amine |
|---|---|
| PubChem CID | 171312582 |
| Molecular Formula | C8H8F5N3 |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 3-[(1R)-1-amino-2,2,3,3,3-pentafluoropropyl]pyridin-2-amine |
| SMILES | Nc1ncccc1[C@@H](N)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H8F5N3/c9-7(10,8(11,12)13)5(14)4-2-1-3-16-6(4)15/h1-3,5H,14H2,(H2,15,16)/t5-/m1/s1 |
| InChIKey | RABQOKDUIGEYDB-RXMQYKEDSA-N |
| XLogP | 1.86 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|