C11H18ClNO2 — CID 171200994
3-[(1R)-1-aminopentyl]benzene-1,2-diol;hydrochloride (PubChem CID 171200994) has the molecular formula C11H18ClNO2 and a molecular weight of 231.72 g/mol. Its IUPAC name is 3-[(1R)-1-aminopentyl]benzene-1,2-diol;hydrochloride.
| Compound Name | 3-[(1R)-1-aminopentyl]benzene-1,2-diol;hydrochloride |
|---|---|
| PubChem CID | 171200994 |
| Molecular Formula | C11H18ClNO2 |
| Molecular Weight | 231.72 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 3-[(1R)-1-aminopentyl]benzene-1,2-diol;hydrochloride |
| SMILES | CCCC[C@@H](N)c1cccc(O)c1O.Cl |
| InChI | InChI=1S/C11H17NO2.ClH/c1-2-3-6-9(12)8-5-4-7-10(13)11(8)14;/h4-5,7,9,13-14H,2-3,6,12H2,1H3;1H/t9-;/m1./s1 |
| InChIKey | CAVZGFQRSPCCFF-SBSPUUFOSA-N |
| XLogP | 2.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.72 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|