C13H15F4N — CID 171230086
(S)-cyclohexyl-(2,3,5,6-tetrafluorophenyl)methanamine (PubChem CID 171230086) has the molecular formula C13H15F4N and a molecular weight of 261.26 g/mol. Its IUPAC name is (S)-cyclohexyl-(2,3,5,6-tetrafluorophenyl)methanamine.
| Compound Name | (S)-cyclohexyl-(2,3,5,6-tetrafluorophenyl)methanamine |
|---|---|
| PubChem CID | 171230086 |
| Molecular Formula | C13H15F4N |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | (S)-cyclohexyl-(2,3,5,6-tetrafluorophenyl)methanamine |
| SMILES | N[C@H](c1c(F)c(F)cc(F)c1F)C1CCCCC1 |
| InChI | InChI=1S/C13H15F4N/c14-8-6-9(15)12(17)10(11(8)16)13(18)7-4-2-1-3-5-7/h6-7,13H,1-5,18H2/t13-/m0/s1 |
| InChIKey | BTVYNGIFCKPQHB-ZDUSSCGKSA-N |
| XLogP | 3.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|