C17H14Cl2F2O — CID 151106233
2,4-bis(2-chloro-6-fluorophenyl)pentan-3-one (PubChem CID 151106233) has the molecular formula C17H14Cl2F2O and a molecular weight of 343.20 g/mol. Its IUPAC name is 2,4-bis(2-chloro-6-fluorophenyl)pentan-3-one.
| Compound Name | 2,4-bis(2-chloro-6-fluorophenyl)pentan-3-one |
|---|---|
| PubChem CID | 151106233 |
| Molecular Formula | C17H14Cl2F2O |
| Molecular Weight | 343.20 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 2,4-bis(2-chloro-6-fluorophenyl)pentan-3-one |
| SMILES | CC(C(=O)C(C)c1c(F)cccc1Cl)c1c(F)cccc1Cl |
| InChI | InChI=1S/C17H14Cl2F2O/c1-9(15-11(18)5-3-7-13(15)20)17(22)10(2)16-12(19)6-4-8-14(16)21/h3-10H,1-2H3 |
| InChIKey | MPDVMKRSGINJDI-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.20 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |