C26H35N3O4 — CID 122586599
3-[4-[ethyl(oxan-3-yl)amino]-3-[(4-methylphenyl)carbamoylamino]phenyl]pentanoic acid (PubChem CID 122586599) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is 3-[4-[ethyl(oxan-3-yl)amino]-3-[(4-methylphenyl)carbamoylamino]phenyl]pentanoic acid.
| Compound Name | 3-[4-[ethyl(oxan-3-yl)amino]-3-[(4-methylphenyl)carbamoylamino]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 122586599 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | 3-[4-[ethyl(oxan-3-yl)amino]-3-[(4-methylphenyl)carbamoylamino]phenyl]pentanoic acid |
| SMILES | CCC(CC(=O)O)c1ccc(N(CC)C2CCCOC2)c(NC(=O)Nc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C26H35N3O4/c1-4-19(16-25(30)31)20-10-13-24(29(5-2)22-7-6-14-33-17-22)23(15-20)28-26(32)27-21-11-8-18(3)9-12-21/h8-13,15,19,22H,4-7,14,16-17H2,1-3H3,(H,30,31)(H2,27,28,32) |
| InChIKey | AVEOERFZHMYRAW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |