C31H36N2O3 — CID 146423335
(3S)-3-[3-[(4-methylphenyl)carbamoylamino]-4-(4-phenylcyclohexyl)phenyl]pentanoic acid (PubChem CID 146423335) has the molecular formula C31H36N2O3 and a molecular weight of 484.64 g/mol. Its IUPAC name is (3S)-3-[3-[(4-methylphenyl)carbamoylamino]-4-(4-phenylcyclohexyl)phenyl]pentanoic acid.
| Compound Name | (3S)-3-[3-[(4-methylphenyl)carbamoylamino]-4-(4-phenylcyclohexyl)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 146423335 |
| Molecular Formula | C31H36N2O3 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | (3S)-3-[3-[(4-methylphenyl)carbamoylamino]-4-(4-phenylcyclohexyl)phenyl]pentanoic acid |
| SMILES | CC[C@@H](CC(=O)O)c1ccc(C2CCC(c3ccccc3)CC2)c(NC(=O)Nc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C31H36N2O3/c1-3-22(20-30(34)35)26-15-18-28(25-13-11-24(12-14-25)23-7-5-4-6-8-23)29(19-26)33-31(36)32-27-16-9-21(2)10-17-27/h4-10,15-19,22,24-25H,3,11-14,20H2,1-2H3,(H,34,35)(H2,32,33,36)/t22-,24?,25?/m0/s1 |
| InChIKey | GCFXMHIWSUYXRP-BSSNWTCHSA-N |
| XLogP | 8.05 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |