C23H30N2O4 — CID 146430882
(3S)-3-[4-[(1R)-1-ethoxyethyl]-3-[(4-methylphenyl)carbamoylamino]phenyl]pentanoic acid (PubChem CID 146430882) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is (3S)-3-[4-[(1R)-1-ethoxyethyl]-3-[(4-methylphenyl)carbamoylamino]phenyl]pentanoic acid.
| Compound Name | (3S)-3-[4-[(1R)-1-ethoxyethyl]-3-[(4-methylphenyl)carbamoylamino]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 146430882 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | (3S)-3-[4-[(1R)-1-ethoxyethyl]-3-[(4-methylphenyl)carbamoylamino]phenyl]pentanoic acid |
| SMILES | CCO[C@H](C)c1ccc([C@@H](CC)CC(=O)O)cc1NC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C23H30N2O4/c1-5-17(14-22(26)27)18-9-12-20(16(4)29-6-2)21(13-18)25-23(28)24-19-10-7-15(3)8-11-19/h7-13,16-17H,5-6,14H2,1-4H3,(H,26,27)(H2,24,25,28)/t16-,17+/m1/s1 |
| InChIKey | QDFOECHJUDRIIT-SJORKVTESA-N |
| XLogP | 5.70 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |