C20H24ClNO3 — CID 146430891
(3R)-3-[3-(4-chloroanilino)-4-[(1R)-1-methoxyethyl]phenyl]pentanoic acid (PubChem CID 146430891) has the molecular formula C20H24ClNO3 and a molecular weight of 361.87 g/mol. Its IUPAC name is (3R)-3-[3-(4-chloroanilino)-4-[(1R)-1-methoxyethyl]phenyl]pentanoic acid.
| Compound Name | (3R)-3-[3-(4-chloroanilino)-4-[(1R)-1-methoxyethyl]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 146430891 |
| Molecular Formula | C20H24ClNO3 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | (3R)-3-[3-(4-chloroanilino)-4-[(1R)-1-methoxyethyl]phenyl]pentanoic acid |
| SMILES | CC[C@H](CC(=O)O)c1ccc([C@@H](C)OC)c(Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C20H24ClNO3/c1-4-14(12-20(23)24)15-5-10-18(13(2)25-3)19(11-15)22-17-8-6-16(21)7-9-17/h5-11,13-14,22H,4,12H2,1-3H3,(H,23,24)/t13-,14-/m1/s1 |
| InChIKey | PIOFRJZPZXUHIN-ZIAGYGMSSA-N |
| XLogP | 5.76 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |