C42H54N3O7P — CID 138740826
bis(phenylmethoxy)phosphoryloxymethyl 3-[4-[bis(2-methylpropyl)amino]-3-[(4-methylphenyl)carbamoylamino]phenyl]pentanoate (PubChem CID 138740826) has the molecular formula C42H54N3O7P and a molecular weight of 743.88 g/mol. Its IUPAC name is bis(phenylmethoxy)phosphoryloxymethyl 3-[4-[bis(2-methylpropyl)amino]-3-[(4-methylphenyl)carbamoylamino]phenyl]pentanoate.
| Compound Name | bis(phenylmethoxy)phosphoryloxymethyl 3-[4-[bis(2-methylpropyl)amino]-3-[(4-methylphenyl)carbamoylamino]phenyl]pentanoate |
|---|---|
| PubChem CID | 138740826 |
| Molecular Formula | C42H54N3O7P |
| Molecular Weight | 743.88 g/mol |
| Exact Mass | 743.37 |
| IUPAC Name | bis(phenylmethoxy)phosphoryloxymethyl 3-[4-[bis(2-methylpropyl)amino]-3-[(4-methylphenyl)carbamoylamino]phenyl]pentanoate |
| SMILES | CCC(CC(=O)OCOP(=O)(OCc1ccccc1)OCc1ccccc1)c1ccc(N(CC(C)C)CC(C)C)c(NC(=O)Nc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C42H54N3O7P/c1-7-36(25-41(46)49-30-52-53(48,50-28-34-14-10-8-11-15-34)51-29-35-16-12-9-13-17-35)37-20-23-40(45(26-31(2)3)27-32(4)5)39(24-37)44-42(47)43-38-21-18-33(6)19-22-38/h8-24,31-32,36H,7,25-30H2,1-6H3,(H2,43,44,47) |
| InChIKey | GEJSXTIWCCEWDI-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.88 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|