C35H54N3O8P — CID 158485066
4-dimethylphosphoryloxybutoxycarbonyloxymethyl (3S)-3-[4-[bis(2-methylpropyl)amino]-3-[(4-methylphenyl)carbamoylamino]phenyl]pentanoate (PubChem CID 158485066) has the molecular formula C35H54N3O8P and a molecular weight of 675.80 g/mol. Its IUPAC name is 4-dimethylphosphoryloxybutoxycarbonyloxymethyl (3S)-3-[4-[bis(2-methylpropyl)amino]-3-[(4-methylphenyl)carbamoylamino]phenyl]pentanoate.
| Compound Name | 4-dimethylphosphoryloxybutoxycarbonyloxymethyl (3S)-3-[4-[bis(2-methylpropyl)amino]-3-[(4-methylphenyl)carbamoylamino]phenyl]pentanoate |
|---|---|
| PubChem CID | 158485066 |
| Molecular Formula | C35H54N3O8P |
| Molecular Weight | 675.80 g/mol |
| Exact Mass | 675.36 |
| IUPAC Name | 4-dimethylphosphoryloxybutoxycarbonyloxymethyl (3S)-3-[4-[bis(2-methylpropyl)amino]-3-[(4-methylphenyl)carbamoylamino]phenyl]pentanoate |
| SMILES | CC[C@@H](CC(=O)OCOC(=O)OCCCCOP(C)(C)=O)c1ccc(N(CC(C)C)CC(C)C)c(NC(=O)Nc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C35H54N3O8P/c1-9-28(21-33(39)44-24-45-35(41)43-18-10-11-19-46-47(7,8)42)29-14-17-32(38(22-25(2)3)23-26(4)5)31(20-29)37-34(40)36-30-15-12-27(6)13-16-30/h12-17,20,25-26,28H,9-11,18-19,21-24H2,1-8H3,(H2,36,37,40)/t28-/m0/s1 |
| InChIKey | BPXUPMJEKPOPFQ-NDEPHWFRSA-N |
| XLogP | 8.63 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.80 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|