C45H58N3O8P — CID 158113452
1-[2-[4-[methyl(phenylmethoxy)phosphoryl]oxyphenyl]acetyl]oxyethyl (3S)-3-[4-[bis(2-methylpropyl)amino]-3-[(4-methylphenyl)carbamoylamino]phenyl]pentanoate (PubChem CID 158113452) has the molecular formula C45H58N3O8P and a molecular weight of 799.95 g/mol. Its IUPAC name is 1-[2-[4-[methyl(phenylmethoxy)phosphoryl]oxyphenyl]acetyl]oxyethyl (3S)-3-[4-[bis(2-methylpropyl)amino]-3-[(4-methylphenyl)carbamoylamino]phenyl]pentanoate.
| Compound Name | 1-[2-[4-[methyl(phenylmethoxy)phosphoryl]oxyphenyl]acetyl]oxyethyl (3S)-3-[4-[bis(2-methylpropyl)amino]-3-[(4-methylphenyl)carbamoylamino]phenyl]pentanoate |
|---|---|
| PubChem CID | 158113452 |
| Molecular Formula | C45H58N3O8P |
| Molecular Weight | 799.95 g/mol |
| Exact Mass | 799.40 |
| IUPAC Name | 1-[2-[4-[methyl(phenylmethoxy)phosphoryl]oxyphenyl]acetyl]oxyethyl (3S)-3-[4-[bis(2-methylpropyl)amino]-3-[(4-methylphenyl)carbamoylamino]phenyl]pentanoate |
| SMILES | CC[C@@H](CC(=O)OC(C)OC(=O)Cc1ccc(OP(C)(=O)OCc2ccccc2)cc1)c1ccc(N(CC(C)C)CC(C)C)c(NC(=O)Nc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C45H58N3O8P/c1-9-37(38-19-24-42(48(28-31(2)3)29-32(4)5)41(26-38)47-45(51)46-39-20-15-33(6)16-21-39)27-44(50)55-34(7)54-43(49)25-35-17-22-40(23-18-35)56-57(8,52)53-30-36-13-11-10-12-14-36/h10-24,26,31-32,34,37H,9,25,27-30H2,1-8H3,(H2,46,47,51)/t34?,37-,57?/m0/s1 |
| InChIKey | JUZBVOYNWZSJPA-HZUBZVCFSA-N |
| XLogP | 10.73 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.95 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|