C28H40N2O2 — CID 122586676
3-[4-[(1-cyclohexyl-2-methylpropyl)amino]-3-(4-methylanilino)phenyl]pentanoic acid (PubChem CID 122586676) has the molecular formula C28H40N2O2 and a molecular weight of 436.64 g/mol. Its IUPAC name is 3-[4-[(1-cyclohexyl-2-methylpropyl)amino]-3-(4-methylanilino)phenyl]pentanoic acid.
| Compound Name | 3-[4-[(1-cyclohexyl-2-methylpropyl)amino]-3-(4-methylanilino)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 122586676 |
| Molecular Formula | C28H40N2O2 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.31 |
| IUPAC Name | 3-[4-[(1-cyclohexyl-2-methylpropyl)amino]-3-(4-methylanilino)phenyl]pentanoic acid |
| SMILES | CCC(CC(=O)O)c1ccc(NC(C(C)C)C2CCCCC2)c(Nc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C28H40N2O2/c1-5-21(18-27(31)32)23-13-16-25(26(17-23)29-24-14-11-20(4)12-15-24)30-28(19(2)3)22-9-7-6-8-10-22/h11-17,19,21-22,28-30H,5-10,18H2,1-4H3,(H,31,32) |
| InChIKey | RVLHHWGORLKEBG-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |