C25H31N3O4S — CID 130297697
3-[3-(4-cyanoanilino)-4-[1-(1,1-dioxothian-4-yl)ethylamino]phenyl]pentanoic acid (PubChem CID 130297697) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is 3-[3-(4-cyanoanilino)-4-[1-(1,1-dioxothian-4-yl)ethylamino]phenyl]pentanoic acid.
| Compound Name | 3-[3-(4-cyanoanilino)-4-[1-(1,1-dioxothian-4-yl)ethylamino]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 130297697 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 3-[3-(4-cyanoanilino)-4-[1-(1,1-dioxothian-4-yl)ethylamino]phenyl]pentanoic acid |
| SMILES | CCC(CC(=O)O)c1ccc(NC(C)C2CCS(=O)(=O)CC2)c(Nc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C25H31N3O4S/c1-3-19(15-25(29)30)21-6-9-23(27-17(2)20-10-12-33(31,32)13-11-20)24(14-21)28-22-7-4-18(16-26)5-8-22/h4-9,14,17,19-20,27-28H,3,10-13,15H2,1-2H3,(H,29,30) |
| InChIKey | WEFBYTDKYIRRIT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |