C23H27N3O3 — CID 122587085
3-[3-(4-cyanoanilino)-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]butanoic acid (PubChem CID 122587085) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 3-[3-(4-cyanoanilino)-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]butanoic acid.
| Compound Name | 3-[3-(4-cyanoanilino)-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 122587085 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 3-[3-(4-cyanoanilino)-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]butanoic acid |
| SMILES | CC(CC(=O)O)c1ccc(N2C[C@@H](C)O[C@@H](C)C2)c(Nc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C23H27N3O3/c1-15(10-23(27)28)19-6-9-22(26-13-16(2)29-17(3)14-26)21(11-19)25-20-7-4-18(12-24)5-8-20/h4-9,11,15-17,25H,10,13-14H2,1-3H3,(H,27,28)/t15?,16-,17+ |
| InChIKey | HSBKKYYHYDYLJO-ALOPSCKCSA-N |
| XLogP | 4.49 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |