C26H33N3O4S — CID 122587402
3-[3-(4-cyanoanilino)-4-[(1,1-dioxothian-4-yl)-propylamino]phenyl]pentanoic acid (PubChem CID 122587402) has the molecular formula C26H33N3O4S and a molecular weight of 483.63 g/mol. Its IUPAC name is 3-[3-(4-cyanoanilino)-4-[(1,1-dioxothian-4-yl)-propylamino]phenyl]pentanoic acid.
| Compound Name | 3-[3-(4-cyanoanilino)-4-[(1,1-dioxothian-4-yl)-propylamino]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 122587402 |
| Molecular Formula | C26H33N3O4S |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 3-[3-(4-cyanoanilino)-4-[(1,1-dioxothian-4-yl)-propylamino]phenyl]pentanoic acid |
| SMILES | CCCN(c1ccc(C(CC)CC(=O)O)cc1Nc1ccc(C#N)cc1)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C26H33N3O4S/c1-3-13-29(23-11-14-34(32,33)15-12-23)25-10-7-21(20(4-2)17-26(30)31)16-24(25)28-22-8-5-19(18-27)6-9-22/h5-10,16,20,23,28H,3-4,11-15,17H2,1-2H3,(H,30,31) |
| InChIKey | KHHPYXJLOVKEKO-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |