C28H30N2O4 — CID 90458836
3-[4-[cyclopropyl(phenyl)methoxy]-3-[(4-methylphenyl)carbamoylamino]phenyl]butanoic acid (PubChem CID 90458836) has the molecular formula C28H30N2O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is 3-[4-[cyclopropyl(phenyl)methoxy]-3-[(4-methylphenyl)carbamoylamino]phenyl]butanoic acid.
| Compound Name | 3-[4-[cyclopropyl(phenyl)methoxy]-3-[(4-methylphenyl)carbamoylamino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 90458836 |
| Molecular Formula | C28H30N2O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 3-[4-[cyclopropyl(phenyl)methoxy]-3-[(4-methylphenyl)carbamoylamino]phenyl]butanoic acid |
| SMILES | Cc1ccc(NC(=O)Nc2cc(C(C)CC(=O)O)ccc2OC(c2ccccc2)C2CC2)cc1 |
| InChI | InChI=1S/C28H30N2O4/c1-18-8-13-23(14-9-18)29-28(33)30-24-17-22(19(2)16-26(31)32)12-15-25(24)34-27(21-10-11-21)20-6-4-3-5-7-20/h3-9,12-15,17,19,21,27H,10-11,16H2,1-2H3,(H,31,32)(H2,29,30,33) |
| InChIKey | DEMSNPIKYBTIEJ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |