C28H30N2O3 — CID 144715854
1-[2-[cyclopropyl(phenyl)methoxy]-5-(4-oxobutan-2-yl)phenyl]-3-(4-methylphenyl)urea (PubChem CID 144715854) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is 1-[2-[cyclopropyl(phenyl)methoxy]-5-(4-oxobutan-2-yl)phenyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[2-[cyclopropyl(phenyl)methoxy]-5-(4-oxobutan-2-yl)phenyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 144715854 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 1-[2-[cyclopropyl(phenyl)methoxy]-5-(4-oxobutan-2-yl)phenyl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2cc(C(C)CC=O)ccc2OC(c2ccccc2)C2CC2)cc1 |
| InChI | InChI=1S/C28H30N2O3/c1-19-8-13-24(14-9-19)29-28(32)30-25-18-23(20(2)16-17-31)12-15-26(25)33-27(22-10-11-22)21-6-4-3-5-7-21/h3-9,12-15,17-18,20,22,27H,10-11,16H2,1-2H3,(H2,29,30,32) |
| InChIKey | XRZAYEHHYJNGJF-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|