C27H30N2O4 — CID 90457617
3-[3-[(4-methylphenyl)carbamoylamino]-4-(3-phenylpropoxy)phenyl]butanoic acid (PubChem CID 90457617) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is 3-[3-[(4-methylphenyl)carbamoylamino]-4-(3-phenylpropoxy)phenyl]butanoic acid.
| Compound Name | 3-[3-[(4-methylphenyl)carbamoylamino]-4-(3-phenylpropoxy)phenyl]butanoic acid |
|---|---|
| PubChem CID | 90457617 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 3-[3-[(4-methylphenyl)carbamoylamino]-4-(3-phenylpropoxy)phenyl]butanoic acid |
| SMILES | Cc1ccc(NC(=O)Nc2cc(C(C)CC(=O)O)ccc2OCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H30N2O4/c1-19-10-13-23(14-11-19)28-27(32)29-24-18-22(20(2)17-26(30)31)12-15-25(24)33-16-6-9-21-7-4-3-5-8-21/h3-5,7-8,10-15,18,20H,6,9,16-17H2,1-2H3,(H,30,31)(H2,28,29,32) |
| InChIKey | ATQRSWOZWFTTRW-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|