C19H23IN2O3 — CID 163905126
1-[2-(2-hydroxyethoxy)-5-(2-iodopropan-2-yl)phenyl]-3-(4-methylphenyl)urea (PubChem CID 163905126) has the molecular formula C19H23IN2O3 and a molecular weight of 454.31 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethoxy)-5-(2-iodopropan-2-yl)phenyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[2-(2-hydroxyethoxy)-5-(2-iodopropan-2-yl)phenyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 163905126 |
| Molecular Formula | C19H23IN2O3 |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 1-[2-(2-hydroxyethoxy)-5-(2-iodopropan-2-yl)phenyl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2cc(C(C)(C)I)ccc2OCCO)cc1 |
| InChI | InChI=1S/C19H23IN2O3/c1-13-4-7-15(8-5-13)21-18(24)22-16-12-14(19(2,3)20)6-9-17(16)25-11-10-23/h4-9,12,23H,10-11H2,1-3H3,(H2,21,22,24) |
| InChIKey | QNGMTWQBJBUWNJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|