C16H17BrN2O3 — CID 19170100
1-(4-bromo-2,5-dimethoxyphenyl)-3-(4-methylphenyl)urea (PubChem CID 19170100) has the molecular formula C16H17BrN2O3 and a molecular weight of 365.23 g/mol. Its IUPAC name is 1-(4-bromo-2,5-dimethoxyphenyl)-3-(4-methylphenyl)urea.
| Compound Name | 1-(4-bromo-2,5-dimethoxyphenyl)-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 19170100 |
| Molecular Formula | C16H17BrN2O3 |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 1-(4-bromo-2,5-dimethoxyphenyl)-3-(4-methylphenyl)urea |
| SMILES | COc1cc(NC(=O)Nc2ccc(C)cc2)c(OC)cc1Br |
| InChI | InChI=1S/C16H17BrN2O3/c1-10-4-6-11(7-5-10)18-16(20)19-13-9-14(21-2)12(17)8-15(13)22-3/h4-9H,1-3H3,(H2,18,19,20) |
| InChIKey | HWDFEDRIEXBLRM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |