C16H15BrN2O3 — CID 108992383
methyl 4-[(2-bromo-4-methylphenyl)carbamoylamino]benzoate (PubChem CID 108992383) has the molecular formula C16H15BrN2O3 and a molecular weight of 363.21 g/mol. Its IUPAC name is methyl 4-[(2-bromo-4-methylphenyl)carbamoylamino]benzoate.
| Compound Name | methyl 4-[(2-bromo-4-methylphenyl)carbamoylamino]benzoate |
|---|---|
| PubChem CID | 108992383 |
| Molecular Formula | C16H15BrN2O3 |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | methyl 4-[(2-bromo-4-methylphenyl)carbamoylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)Nc2ccc(C)cc2Br)cc1 |
| InChI | InChI=1S/C16H15BrN2O3/c1-10-3-8-14(13(17)9-10)19-16(21)18-12-6-4-11(5-7-12)15(20)22-2/h3-9H,1-2H3,(H2,18,19,21) |
| InChIKey | LUSBHSQTALXDFU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |