C16H17BrN2O — CID 108991373
1-(2-bromo-4-methylphenyl)-3-(3,5-dimethylphenyl)urea (PubChem CID 108991373) has the molecular formula C16H17BrN2O and a molecular weight of 333.23 g/mol. Its IUPAC name is 1-(2-bromo-4-methylphenyl)-3-(3,5-dimethylphenyl)urea.
| Compound Name | 1-(2-bromo-4-methylphenyl)-3-(3,5-dimethylphenyl)urea |
|---|---|
| PubChem CID | 108991373 |
| Molecular Formula | C16H17BrN2O |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 1-(2-bromo-4-methylphenyl)-3-(3,5-dimethylphenyl)urea |
| SMILES | Cc1cc(C)cc(NC(=O)Nc2ccc(C)cc2Br)c1 |
| InChI | InChI=1S/C16H17BrN2O/c1-10-4-5-15(14(17)9-10)19-16(20)18-13-7-11(2)6-12(3)8-13/h4-9H,1-3H3,(H2,18,19,20) |
| InChIKey | FCYSSFMQBLZBRZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |