C19H25N3O7 — CID 102050218
tert-butyl 4-[(2S)-1-(2,4-dinitrophenyl)-3-oxopropan-2-yl]piperidine-1-carboxylate (PubChem CID 102050218) has the molecular formula C19H25N3O7 and a molecular weight of 407.42 g/mol. Its IUPAC name is tert-butyl 4-[(2S)-1-(2,4-dinitrophenyl)-3-oxopropan-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2S)-1-(2,4-dinitrophenyl)-3-oxopropan-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 102050218 |
| Molecular Formula | C19H25N3O7 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | tert-butyl 4-[(2S)-1-(2,4-dinitrophenyl)-3-oxopropan-2-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC([C@@H](C=O)Cc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H25N3O7/c1-19(2,3)29-18(24)20-8-6-13(7-9-20)15(12-23)10-14-4-5-16(21(25)26)11-17(14)22(27)28/h4-5,11-13,15H,6-10H2,1-3H3/t15-/m1/s1 |
| InChIKey | CJTBLVWVEHGWDL-OAHLLOKOSA-N |
| XLogP | 3.51 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|