C21H30N2O6 — CID 157227706
tert-butyl 4-[2-(2-hydroxy-5-nitro-4-propylphenyl)-2-oxoethyl]piperidine-1-carboxylate (PubChem CID 157227706) has the molecular formula C21H30N2O6 and a molecular weight of 406.48 g/mol. Its IUPAC name is tert-butyl 4-[2-(2-hydroxy-5-nitro-4-propylphenyl)-2-oxoethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(2-hydroxy-5-nitro-4-propylphenyl)-2-oxoethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 157227706 |
| Molecular Formula | C21H30N2O6 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | tert-butyl 4-[2-(2-hydroxy-5-nitro-4-propylphenyl)-2-oxoethyl]piperidine-1-carboxylate |
| SMILES | CCCc1cc(O)c(C(=O)CC2CCN(C(=O)OC(C)(C)C)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H30N2O6/c1-5-6-15-12-19(25)16(13-17(15)23(27)28)18(24)11-14-7-9-22(10-8-14)20(26)29-21(2,3)4/h12-14,25H,5-11H2,1-4H3 |
| InChIKey | ATSQXHVPEBTQBN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|