C16H21IN2O5 — CID 171408597
tert-butyl 4-(4-hydroxy-3-iodo-5-nitrophenyl)piperidine-1-carboxylate (PubChem CID 171408597) has the molecular formula C16H21IN2O5 and a molecular weight of 448.26 g/mol. Its IUPAC name is tert-butyl 4-(4-hydroxy-3-iodo-5-nitrophenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-hydroxy-3-iodo-5-nitrophenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171408597 |
| Molecular Formula | C16H21IN2O5 |
| Molecular Weight | 448.26 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | tert-butyl 4-(4-hydroxy-3-iodo-5-nitrophenyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cc(I)c(O)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C16H21IN2O5/c1-16(2,3)24-15(21)18-6-4-10(5-7-18)11-8-12(17)14(20)13(9-11)19(22)23/h8-10,20H,4-7H2,1-3H3 |
| InChIKey | RSGXVVOMERQNDZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.26 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|