C18H23N3O2S — CID 71303203
tert-butyl 4-quinoxalin-2-ylsulfanylpiperidine-1-carboxylate (PubChem CID 71303203) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is tert-butyl 4-quinoxalin-2-ylsulfanylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-quinoxalin-2-ylsulfanylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 71303203 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | tert-butyl 4-quinoxalin-2-ylsulfanylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Sc2cnc3ccccc3n2)CC1 |
| InChI | InChI=1S/C18H23N3O2S/c1-18(2,3)23-17(22)21-10-8-13(9-11-21)24-16-12-19-14-6-4-5-7-15(14)20-16/h4-7,12-13H,8-11H2,1-3H3 |
| InChIKey | IKZGGXVHDJOLNB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |