C23H26N2O4S — CID 66877134
tert-butyl 3-[4-(2-cyanophenyl)sulfinyl-2-methoxyphenyl]pyrrolidine-1-carboxylate (PubChem CID 66877134) has the molecular formula C23H26N2O4S and a molecular weight of 426.54 g/mol. Its IUPAC name is tert-butyl 3-[4-(2-cyanophenyl)sulfinyl-2-methoxyphenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(2-cyanophenyl)sulfinyl-2-methoxyphenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66877134 |
| Molecular Formula | C23H26N2O4S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | tert-butyl 3-[4-(2-cyanophenyl)sulfinyl-2-methoxyphenyl]pyrrolidine-1-carboxylate |
| SMILES | COc1cc(S(=O)c2ccccc2C#N)ccc1C1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C23H26N2O4S/c1-23(2,3)29-22(26)25-12-11-17(15-25)19-10-9-18(13-20(19)28-4)30(27)21-8-6-5-7-16(21)14-24/h5-10,13,17H,11-12,15H2,1-4H3 |
| InChIKey | DIBKKNXMNMUHDO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |