C18H25FN2O3 — CID 118550108
tert-butyl 3-(4-amino-5-cyclopropyloxy-2-fluorophenyl)pyrrolidine-1-carboxylate (PubChem CID 118550108) has the molecular formula C18H25FN2O3 and a molecular weight of 336.41 g/mol. Its IUPAC name is tert-butyl 3-(4-amino-5-cyclopropyloxy-2-fluorophenyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-amino-5-cyclopropyloxy-2-fluorophenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118550108 |
| Molecular Formula | C18H25FN2O3 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | tert-butyl 3-(4-amino-5-cyclopropyloxy-2-fluorophenyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cc(OC3CC3)c(N)cc2F)C1 |
| InChI | InChI=1S/C18H25FN2O3/c1-18(2,3)24-17(22)21-7-6-11(10-21)13-8-16(23-12-4-5-12)15(20)9-14(13)19/h8-9,11-12H,4-7,10,20H2,1-3H3 |
| InChIKey | OEGSAQXWSTXMEG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|