C20H28N2O3 — CID 22048588
tert-butyl 4-[3-(2-oxopyrrolidin-1-yl)phenyl]piperidine-1-carboxylate (PubChem CID 22048588) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is tert-butyl 4-[3-(2-oxopyrrolidin-1-yl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(2-oxopyrrolidin-1-yl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22048588 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | tert-butyl 4-[3-(2-oxopyrrolidin-1-yl)phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cccc(N3CCCC3=O)c2)CC1 |
| InChI | InChI=1S/C20H28N2O3/c1-20(2,3)25-19(24)21-12-9-15(10-13-21)16-6-4-7-17(14-16)22-11-5-8-18(22)23/h4,6-7,14-15H,5,8-13H2,1-3H3 |
| InChIKey | ISDZBATWANXXCN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |