C14H20Cl6N2O6 — CID 134818175
bis(1,1,1-trichloro-2-methylpropan-2-yl) 2,5-dihydroxypiperazine-1,4-dicarboxylate (PubChem CID 134818175) has the molecular formula C14H20Cl6N2O6 and a molecular weight of 525.04 g/mol. Its IUPAC name is bis(1,1,1-trichloro-2-methylpropan-2-yl) 2,5-dihydroxypiperazine-1,4-dicarboxylate.
| Compound Name | bis(1,1,1-trichloro-2-methylpropan-2-yl) 2,5-dihydroxypiperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 134818175 |
| Molecular Formula | C14H20Cl6N2O6 |
| Molecular Weight | 525.04 g/mol |
| Exact Mass | 521.95 |
| IUPAC Name | bis(1,1,1-trichloro-2-methylpropan-2-yl) 2,5-dihydroxypiperazine-1,4-dicarboxylate |
| SMILES | CC(C)(OC(=O)N1CC(O)N(C(=O)OC(C)(C)C(Cl)(Cl)Cl)CC1O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H20Cl6N2O6/c1-11(2,13(15,16)17)27-9(25)21-5-8(24)22(6-7(21)23)10(26)28-12(3,4)14(18,19)20/h7-8,23-24H,5-6H2,1-4H3 |
| InChIKey | UQMJSEROVIYYNF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.04 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|