C12H18Cl3NO5 — CID 175698723
2-[4-hydroxy-1-(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonylpiperidin-4-yl]acetic acid (PubChem CID 175698723) has the molecular formula C12H18Cl3NO5 and a molecular weight of 362.64 g/mol. Its IUPAC name is 2-[4-hydroxy-1-(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonylpiperidin-4-yl]acetic acid.
| Compound Name | 2-[4-hydroxy-1-(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonylpiperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 175698723 |
| Molecular Formula | C12H18Cl3NO5 |
| Molecular Weight | 362.64 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 2-[4-hydroxy-1-(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonylpiperidin-4-yl]acetic acid |
| SMILES | CC(C)(OC(=O)N1CCC(O)(CC(=O)O)CC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H18Cl3NO5/c1-10(2,12(13,14)15)21-9(19)16-5-3-11(20,4-6-16)7-8(17)18/h20H,3-7H2,1-2H3,(H,17,18) |
| InChIKey | PKIGTVWOSJSILT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.64 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|