C19H33NO3 — CID 123972526
tert-butyl 4-hydroxy-4-(3-methyl-2-propan-2-ylidenepent-3-enyl)piperidine-1-carboxylate (PubChem CID 123972526) has the molecular formula C19H33NO3 and a molecular weight of 323.48 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-4-(3-methyl-2-propan-2-ylidenepent-3-enyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-hydroxy-4-(3-methyl-2-propan-2-ylidenepent-3-enyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123972526 |
| Molecular Formula | C19H33NO3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.25 |
| IUPAC Name | tert-butyl 4-hydroxy-4-(3-methyl-2-propan-2-ylidenepent-3-enyl)piperidine-1-carboxylate |
| SMILES | CC=C(C)C(CC1(O)CCN(C(=O)OC(C)(C)C)CC1)=C(C)C |
| InChI | InChI=1S/C19H33NO3/c1-8-15(4)16(14(2)3)13-19(22)9-11-20(12-10-19)17(21)23-18(5,6)7/h8,22H,9-13H2,1-7H3 |
| InChIKey | GUENUFHZJSTCHH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|