C13H21Cl3N2O4S — CID 156636643
(1,1,1-trichloro-2-methylpropan-2-yl) 3-[2-[ethyl(methyl)amino]-2-oxo-1-sulfanylethyl]-3-hydroxyazetidine-1-carboxylate (PubChem CID 156636643) has the molecular formula C13H21Cl3N2O4S and a molecular weight of 407.75 g/mol. Its IUPAC name is (1,1,1-trichloro-2-methylpropan-2-yl) 3-[2-[ethyl(methyl)amino]-2-oxo-1-sulfanylethyl]-3-hydroxyazetidine-1-carboxylate.
| Compound Name | (1,1,1-trichloro-2-methylpropan-2-yl) 3-[2-[ethyl(methyl)amino]-2-oxo-1-sulfanylethyl]-3-hydroxyazetidine-1-carboxylate |
|---|---|
| PubChem CID | 156636643 |
| Molecular Formula | C13H21Cl3N2O4S |
| Molecular Weight | 407.75 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | (1,1,1-trichloro-2-methylpropan-2-yl) 3-[2-[ethyl(methyl)amino]-2-oxo-1-sulfanylethyl]-3-hydroxyazetidine-1-carboxylate |
| SMILES | CCN(C)C(=O)C(S)C1(O)CN(C(=O)OC(C)(C)C(Cl)(Cl)Cl)C1 |
| InChI | InChI=1S/C13H21Cl3N2O4S/c1-5-17(4)9(19)8(23)12(21)6-18(7-12)10(20)22-11(2,3)13(14,15)16/h8,21,23H,5-7H2,1-4H3 |
| InChIKey | WARLXMSFKIQRKA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.75 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|