C12H11ClN2O3 — CID 117225195
methyl 4-(3-chlorophenyl)-3-methyl-2-oxo-1H-imidazole-5-carboxylate (PubChem CID 117225195) has the molecular formula C12H11ClN2O3 and a molecular weight of 266.68 g/mol. Its IUPAC name is methyl 4-(3-chlorophenyl)-3-methyl-2-oxo-1H-imidazole-5-carboxylate.
| Compound Name | methyl 4-(3-chlorophenyl)-3-methyl-2-oxo-1H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 117225195 |
| Molecular Formula | C12H11ClN2O3 |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | methyl 4-(3-chlorophenyl)-3-methyl-2-oxo-1H-imidazole-5-carboxylate |
| SMILES | COC(=O)c1[nH]c(=O)n(C)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H11ClN2O3/c1-15-10(7-4-3-5-8(13)6-7)9(11(16)18-2)14-12(15)17/h3-6H,1-2H3,(H,14,17) |
| InChIKey | BZPSTHGTIGDGIO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |