C21H23N3O4 — CID 69335099
N-(dimethylaminomethylidene)-5,6-dimethoxy-3-(4-methoxyphenyl)-1H-indole-2-carboxamide (PubChem CID 69335099) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is N-(dimethylaminomethylidene)-5,6-dimethoxy-3-(4-methoxyphenyl)-1H-indole-2-carboxamide.
| Compound Name | N-(dimethylaminomethylidene)-5,6-dimethoxy-3-(4-methoxyphenyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 69335099 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N-(dimethylaminomethylidene)-5,6-dimethoxy-3-(4-methoxyphenyl)-1H-indole-2-carboxamide |
| SMILES | COc1ccc(-c2c(C(=O)/N=C/N(C)C)[nH]c3cc(OC)c(OC)cc23)cc1 |
| InChI | InChI=1S/C21H23N3O4/c1-24(2)12-22-21(25)20-19(13-6-8-14(26-3)9-7-13)15-10-17(27-4)18(28-5)11-16(15)23-20/h6-12,23H,1-5H3/b22-12+ |
| InChIKey | AGJPJYIUJKCZIX-WSDLNYQXSA-N |
| XLogP | 3.59 |
| TPSA | 76.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|