C20H19BrN2O4 — CID 102085343
2-[3-(4-bromophenyl)-4,6-dimethoxy-1H-indol-2-yl]-N,N-dimethyl-2-oxoacetamide (PubChem CID 102085343) has the molecular formula C20H19BrN2O4 and a molecular weight of 431.29 g/mol. Its IUPAC name is 2-[3-(4-bromophenyl)-4,6-dimethoxy-1H-indol-2-yl]-N,N-dimethyl-2-oxoacetamide.
| Compound Name | 2-[3-(4-bromophenyl)-4,6-dimethoxy-1H-indol-2-yl]-N,N-dimethyl-2-oxoacetamide |
|---|---|
| PubChem CID | 102085343 |
| Molecular Formula | C20H19BrN2O4 |
| Molecular Weight | 431.29 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 2-[3-(4-bromophenyl)-4,6-dimethoxy-1H-indol-2-yl]-N,N-dimethyl-2-oxoacetamide |
| SMILES | COc1cc(OC)c2c(-c3ccc(Br)cc3)c(C(=O)C(=O)N(C)C)[nH]c2c1 |
| InChI | InChI=1S/C20H19BrN2O4/c1-23(2)20(25)19(24)18-16(11-5-7-12(21)8-6-11)17-14(22-18)9-13(26-3)10-15(17)27-4/h5-10,22H,1-4H3 |
| InChIKey | ACIYKIWWOINEIU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|