C18H16FNO4 — CID 10806224
2-(4-fluorophenyl)-3,5,7-trimethoxy-1H-quinolin-4-one (PubChem CID 10806224) has the molecular formula C18H16FNO4 and a molecular weight of 329.33 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3,5,7-trimethoxy-1H-quinolin-4-one.
| Compound Name | 2-(4-fluorophenyl)-3,5,7-trimethoxy-1H-quinolin-4-one |
|---|---|
| PubChem CID | 10806224 |
| Molecular Formula | C18H16FNO4 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-(4-fluorophenyl)-3,5,7-trimethoxy-1H-quinolin-4-one |
| SMILES | COc1cc(OC)c2c(=O)c(OC)c(-c3ccc(F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C18H16FNO4/c1-22-12-8-13-15(14(9-12)23-2)17(21)18(24-3)16(20-13)10-4-6-11(19)7-5-10/h4-9H,1-3H3,(H,20,21) |
| InChIKey | CIAQDIDLBCEEND-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |