C23H23ClN2O4 — CID 118727765
1-[3-(4-chlorophenyl)-4,6-dimethoxy-1H-indol-2-yl]-2-piperidin-1-ylethane-1,2-dione (PubChem CID 118727765) has the molecular formula C23H23ClN2O4 and a molecular weight of 426.90 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)-4,6-dimethoxy-1H-indol-2-yl]-2-piperidin-1-ylethane-1,2-dione.
| Compound Name | 1-[3-(4-chlorophenyl)-4,6-dimethoxy-1H-indol-2-yl]-2-piperidin-1-ylethane-1,2-dione |
|---|---|
| PubChem CID | 118727765 |
| Molecular Formula | C23H23ClN2O4 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 1-[3-(4-chlorophenyl)-4,6-dimethoxy-1H-indol-2-yl]-2-piperidin-1-ylethane-1,2-dione |
| SMILES | COc1cc(OC)c2c(-c3ccc(Cl)cc3)c(C(=O)C(=O)N3CCCCC3)[nH]c2c1 |
| InChI | InChI=1S/C23H23ClN2O4/c1-29-16-12-17-20(18(13-16)30-2)19(14-6-8-15(24)9-7-14)21(25-17)22(27)23(28)26-10-4-3-5-11-26/h6-9,12-13,25H,3-5,10-11H2,1-2H3 |
| InChIKey | DIVXGQAFBPOLCM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|