C15H20ClNO4 — CID 62224814
2-chloro-1-pyrrolidin-1-yl-2-(2,4,6-trimethoxyphenyl)ethanone (PubChem CID 62224814) has the molecular formula C15H20ClNO4 and a molecular weight of 313.78 g/mol. Its IUPAC name is 2-chloro-1-pyrrolidin-1-yl-2-(2,4,6-trimethoxyphenyl)ethanone.
| Compound Name | 2-chloro-1-pyrrolidin-1-yl-2-(2,4,6-trimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 62224814 |
| Molecular Formula | C15H20ClNO4 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-chloro-1-pyrrolidin-1-yl-2-(2,4,6-trimethoxyphenyl)ethanone |
| SMILES | COc1cc(OC)c(C(Cl)C(=O)N2CCCC2)c(OC)c1 |
| InChI | InChI=1S/C15H20ClNO4/c1-19-10-8-11(20-2)13(12(9-10)21-3)14(16)15(18)17-6-4-5-7-17/h8-9,14H,4-7H2,1-3H3 |
| InChIKey | UDJATWHTYIIDSL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|