C25H32Cl2O7 — CID 141161377
1,7-dichloro-1,7-bis(2,4,6-trimethoxyphenyl)heptan-4-one (PubChem CID 141161377) has the molecular formula C25H32Cl2O7 and a molecular weight of 515.43 g/mol. Its IUPAC name is 1,7-dichloro-1,7-bis(2,4,6-trimethoxyphenyl)heptan-4-one.
| Compound Name | 1,7-dichloro-1,7-bis(2,4,6-trimethoxyphenyl)heptan-4-one |
|---|---|
| PubChem CID | 141161377 |
| Molecular Formula | C25H32Cl2O7 |
| Molecular Weight | 515.43 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | 1,7-dichloro-1,7-bis(2,4,6-trimethoxyphenyl)heptan-4-one |
| SMILES | COc1cc(OC)c(C(Cl)CCC(=O)CCC(Cl)c2c(OC)cc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C25H32Cl2O7/c1-29-16-11-20(31-3)24(21(12-16)32-4)18(26)9-7-15(28)8-10-19(27)25-22(33-5)13-17(30-2)14-23(25)34-6/h11-14,18-19H,7-10H2,1-6H3 |
| InChIKey | CRDVFUUAFYCDTN-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.43 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|