C15H15ClN2O2 — CID 113208208
1-(5-chloro-1H-indol-3-yl)-2-piperidin-1-ylethane-1,2-dione (PubChem CID 113208208) has the molecular formula C15H15ClN2O2 and a molecular weight of 290.75 g/mol. Its IUPAC name is 1-(5-chloro-1H-indol-3-yl)-2-piperidin-1-ylethane-1,2-dione.
| Compound Name | 1-(5-chloro-1H-indol-3-yl)-2-piperidin-1-ylethane-1,2-dione |
|---|---|
| PubChem CID | 113208208 |
| Molecular Formula | C15H15ClN2O2 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 1-(5-chloro-1H-indol-3-yl)-2-piperidin-1-ylethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCCCC1)c1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C15H15ClN2O2/c16-10-4-5-13-11(8-10)12(9-17-13)14(19)15(20)18-6-2-1-3-7-18/h4-5,8-9,17H,1-3,6-7H2 |
| InChIKey | ANANHDYTYBIPTI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|