C27H31N3O3 — CID 50846882
3-[2-(azepan-1-yl)-2-oxoacetyl]-N-[1-(2,4-dimethylphenyl)ethyl]-1H-indole-5-carboxamide (PubChem CID 50846882) has the molecular formula C27H31N3O3 and a molecular weight of 445.56 g/mol. Its IUPAC name is 3-[2-(azepan-1-yl)-2-oxoacetyl]-N-[1-(2,4-dimethylphenyl)ethyl]-1H-indole-5-carboxamide.
| Compound Name | 3-[2-(azepan-1-yl)-2-oxoacetyl]-N-[1-(2,4-dimethylphenyl)ethyl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 50846882 |
| Molecular Formula | C27H31N3O3 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 3-[2-(azepan-1-yl)-2-oxoacetyl]-N-[1-(2,4-dimethylphenyl)ethyl]-1H-indole-5-carboxamide |
| SMILES | Cc1ccc(C(C)NC(=O)c2ccc3[nH]cc(C(=O)C(=O)N4CCCCCC4)c3c2)c(C)c1 |
| InChI | InChI=1S/C27H31N3O3/c1-17-8-10-21(18(2)14-17)19(3)29-26(32)20-9-11-24-22(15-20)23(16-28-24)25(31)27(33)30-12-6-4-5-7-13-30/h8-11,14-16,19,28H,4-7,12-13H2,1-3H3,(H,29,32) |
| InChIKey | ZHAQOXJXXIMKMI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|