C12H10NO5- — CID 6954124
3-formyl-5,6-dimethoxy-1H-indole-2-carboxylate (PubChem CID 6954124) has the molecular formula C12H10NO5- and a molecular weight of 248.21 g/mol. Its IUPAC name is 3-formyl-5,6-dimethoxy-1H-indole-2-carboxylate.
| Compound Name | 3-formyl-5,6-dimethoxy-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 6954124 |
| Molecular Formula | C12H10NO5- |
| Molecular Weight | 248.21 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 3-formyl-5,6-dimethoxy-1H-indole-2-carboxylate |
| SMILES | COc1cc2[nH]c(C(=O)[O-])c(C=O)c2cc1OC |
| InChI | InChI=1S/C12H11NO5/c1-17-9-3-6-7(5-14)11(12(15)16)13-8(6)4-10(9)18-2/h3-5,13H,1-2H3,(H,15,16)/p-1 |
| InChIKey | QVAZMCCSENVCPR-UHFFFAOYSA-M |
| XLogP | 0.36 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.21 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|