C25H24N2O2 — CID 141115498
5-(4-tert-butylanilino)-3-phenyl-1H-indole-2-carboxylic acid (PubChem CID 141115498) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 5-(4-tert-butylanilino)-3-phenyl-1H-indole-2-carboxylic acid.
| Compound Name | 5-(4-tert-butylanilino)-3-phenyl-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 141115498 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 5-(4-tert-butylanilino)-3-phenyl-1H-indole-2-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(Nc2ccc3[nH]c(C(=O)O)c(-c4ccccc4)c3c2)cc1 |
| InChI | InChI=1S/C25H24N2O2/c1-25(2,3)17-9-11-18(12-10-17)26-19-13-14-21-20(15-19)22(23(27-21)24(28)29)16-7-5-4-6-8-16/h4-15,26-27H,1-3H3,(H,28,29) |
| InChIKey | VLKAAJYYMZVAKO-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |