C25H23ClN2O4S — CID 68851208
5-[(4-tert-butylphenyl)sulfonylamino]-3-(3-chlorophenyl)-1H-indole-2-carboxylic acid (PubChem CID 68851208) has the molecular formula C25H23ClN2O4S and a molecular weight of 482.99 g/mol. Its IUPAC name is 5-[(4-tert-butylphenyl)sulfonylamino]-3-(3-chlorophenyl)-1H-indole-2-carboxylic acid.
| Compound Name | 5-[(4-tert-butylphenyl)sulfonylamino]-3-(3-chlorophenyl)-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 68851208 |
| Molecular Formula | C25H23ClN2O4S |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 5-[(4-tert-butylphenyl)sulfonylamino]-3-(3-chlorophenyl)-1H-indole-2-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc3[nH]c(C(=O)O)c(-c4cccc(Cl)c4)c3c2)cc1 |
| InChI | InChI=1S/C25H23ClN2O4S/c1-25(2,3)16-7-10-19(11-8-16)33(31,32)28-18-9-12-21-20(14-18)22(23(27-21)24(29)30)15-5-4-6-17(26)13-15/h4-14,27-28H,1-3H3,(H,29,30) |
| InChIKey | MMDIAZHSMIFWPU-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |