C25H24N2O5S — CID 68849323
[5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] hydrogen carbonate (PubChem CID 68849323) has the molecular formula C25H24N2O5S and a molecular weight of 464.54 g/mol. Its IUPAC name is [5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] hydrogen carbonate.
| Compound Name | [5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 68849323 |
| Molecular Formula | C25H24N2O5S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | [5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] hydrogen carbonate |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc3[nH]c(OC(=O)O)c(-c4ccccc4)c3c2)cc1 |
| InChI | InChI=1S/C25H24N2O5S/c1-25(2,3)17-9-12-19(13-10-17)33(30,31)27-18-11-14-21-20(15-18)22(16-7-5-4-6-8-16)23(26-21)32-24(28)29/h4-15,26-27H,1-3H3,(H,28,29) |
| InChIKey | KPEVYMXNXACDPF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |