C31H29N3O5S — CID 68850374
[5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] N-(4-hydroxyphenyl)carbamate (PubChem CID 68850374) has the molecular formula C31H29N3O5S and a molecular weight of 555.66 g/mol. Its IUPAC name is [5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] N-(4-hydroxyphenyl)carbamate.
| Compound Name | [5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] N-(4-hydroxyphenyl)carbamate |
|---|---|
| PubChem CID | 68850374 |
| Molecular Formula | C31H29N3O5S |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | [5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] N-(4-hydroxyphenyl)carbamate |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc3[nH]c(OC(=O)Nc4ccc(O)cc4)c(-c4ccccc4)c3c2)cc1 |
| InChI | InChI=1S/C31H29N3O5S/c1-31(2,3)21-9-16-25(17-10-21)40(37,38)34-23-13-18-27-26(19-23)28(20-7-5-4-6-8-20)29(33-27)39-30(36)32-22-11-14-24(35)15-12-22/h4-19,33-35H,1-3H3,(H,32,36) |
| InChIKey | JKFJSVPUAQCFCP-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|