C28H31N3O5S — CID 69178515
[5-[(4-tert-butylphenyl)sulfamoyl]-3-phenyl-1H-indol-2-yl] N-(2-hydroxypropyl)carbamate (PubChem CID 69178515) has the molecular formula C28H31N3O5S and a molecular weight of 521.64 g/mol. Its IUPAC name is [5-[(4-tert-butylphenyl)sulfamoyl]-3-phenyl-1H-indol-2-yl] N-(2-hydroxypropyl)carbamate.
| Compound Name | [5-[(4-tert-butylphenyl)sulfamoyl]-3-phenyl-1H-indol-2-yl] N-(2-hydroxypropyl)carbamate |
|---|---|
| PubChem CID | 69178515 |
| Molecular Formula | C28H31N3O5S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | [5-[(4-tert-butylphenyl)sulfamoyl]-3-phenyl-1H-indol-2-yl] N-(2-hydroxypropyl)carbamate |
| SMILES | CC(O)CNC(=O)Oc1[nH]c2ccc(S(=O)(=O)Nc3ccc(C(C)(C)C)cc3)cc2c1-c1ccccc1 |
| InChI | InChI=1S/C28H31N3O5S/c1-18(32)17-29-27(33)36-26-25(19-8-6-5-7-9-19)23-16-22(14-15-24(23)30-26)37(34,35)31-21-12-10-20(11-13-21)28(2,3)4/h5-16,18,30-32H,17H2,1-4H3,(H,29,33) |
| InChIKey | RNDMMQVFQCRLEF-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |