C29H31FN4O5S — CID 68850757
[5-[(4-tert-butylphenyl)sulfonylamino]-3-(3-fluorophenyl)-1H-indol-2-yl] N-(2-acetamidoethyl)carbamate (PubChem CID 68850757) has the molecular formula C29H31FN4O5S and a molecular weight of 566.66 g/mol. Its IUPAC name is [5-[(4-tert-butylphenyl)sulfonylamino]-3-(3-fluorophenyl)-1H-indol-2-yl] N-(2-acetamidoethyl)carbamate.
| Compound Name | [5-[(4-tert-butylphenyl)sulfonylamino]-3-(3-fluorophenyl)-1H-indol-2-yl] N-(2-acetamidoethyl)carbamate |
|---|---|
| PubChem CID | 68850757 |
| Molecular Formula | C29H31FN4O5S |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | [5-[(4-tert-butylphenyl)sulfonylamino]-3-(3-fluorophenyl)-1H-indol-2-yl] N-(2-acetamidoethyl)carbamate |
| SMILES | CC(=O)NCCNC(=O)Oc1[nH]c2ccc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)cc2c1-c1cccc(F)c1 |
| InChI | InChI=1S/C29H31FN4O5S/c1-18(35)31-14-15-32-28(36)39-27-26(19-6-5-7-21(30)16-19)24-17-22(10-13-25(24)33-27)34-40(37,38)23-11-8-20(9-12-23)29(2,3)4/h5-13,16-17,33-34H,14-15H2,1-4H3,(H,31,35)(H,32,36) |
| InChIKey | UNPKOSSLFDURQN-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|