C28H30N2O6S — CID 68847968
[5-[(4-tert-butylphenyl)sulfonylamino]-3-(3-methoxyphenyl)-1H-indol-2-yl] ethyl carbonate (PubChem CID 68847968) has the molecular formula C28H30N2O6S and a molecular weight of 522.62 g/mol. Its IUPAC name is [5-[(4-tert-butylphenyl)sulfonylamino]-3-(3-methoxyphenyl)-1H-indol-2-yl] ethyl carbonate.
| Compound Name | [5-[(4-tert-butylphenyl)sulfonylamino]-3-(3-methoxyphenyl)-1H-indol-2-yl] ethyl carbonate |
|---|---|
| PubChem CID | 68847968 |
| Molecular Formula | C28H30N2O6S |
| Molecular Weight | 522.62 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | [5-[(4-tert-butylphenyl)sulfonylamino]-3-(3-methoxyphenyl)-1H-indol-2-yl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1[nH]c2ccc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)cc2c1-c1cccc(OC)c1 |
| InChI | InChI=1S/C28H30N2O6S/c1-6-35-27(31)36-26-25(18-8-7-9-21(16-18)34-5)23-17-20(12-15-24(23)29-26)30-37(32,33)22-13-10-19(11-14-22)28(2,3)4/h7-17,29-30H,6H2,1-5H3 |
| InChIKey | SGDRHWFYMLOPMB-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 106.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.62 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |